C20H25N3O9 — CID 170359014
2-[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]propanoylamino]pentanedioic acid (PubChem CID 170359014) has the molecular formula C20H25N3O9 and a molecular weight of 451.43 g/mol. Its IUPAC name is 2-[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 170359014 |
| Molecular Formula | C20H25N3O9 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]propanoylamino]pentanedioic acid |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C20H25N3O9/c1-11(19(29)23-13(20(30)31)5-8-18(27)28)22-17(26)10-21-16(25)7-4-12-3-6-14(24)15(9-12)32-2/h3-4,6-7,9,11,13,24H,5,8,10H2,1-2H3,(H,21,25)(H,22,26)(H,23,29)(H,27,28)(H,30,31)/b7-4+ |
| InChIKey | DIUUTMZNJCBGTC-QPJJXVBHSA-N |
| XLogP | -0.53 |
| TPSA | 191.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|