C15H16O7 — CID 175321017
2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]pentanedioic acid (PubChem CID 175321017) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]pentanedioic acid.
| Compound Name | 2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]pentanedioic acid |
|---|---|
| PubChem CID | 175321017 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]pentanedioic acid |
| SMILES | COc1cc(C=CC(=O)C(CCC(=O)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C15H16O7/c1-22-13-8-9(3-6-12(13)17)2-5-11(16)10(15(20)21)4-7-14(18)19/h2-3,5-6,8,10,17H,4,7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | QSXWKAYDBODZTL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|