C25H26O8 — CID 74385235
ethyl 6-(4-hydroxy-3-methoxyphenyl)-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4-oxohex-5-enoate (PubChem CID 74385235) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is ethyl 6-(4-hydroxy-3-methoxyphenyl)-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4-oxohex-5-enoate.
| Compound Name | ethyl 6-(4-hydroxy-3-methoxyphenyl)-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 74385235 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | ethyl 6-(4-hydroxy-3-methoxyphenyl)-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4-oxohex-5-enoate |
| SMILES | CCOC(=O)CC(C(=O)C=Cc1ccc(O)c(OC)c1)C(=O)C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C25H26O8/c1-4-33-25(30)15-18(19(26)9-5-16-7-11-21(28)23(13-16)31-2)20(27)10-6-17-8-12-22(29)24(14-17)32-3/h5-14,18,28-29H,4,15H2,1-3H3 |
| InChIKey | NKESOMLFLDHHIT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|