C24H22O8 — CID 123807494
(E)-4-[(E)-3-(3-formyl-4-hydroxyphenyl)prop-2-enoyl]-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-6-enoic acid (PubChem CID 123807494) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is (E)-4-[(E)-3-(3-formyl-4-hydroxyphenyl)prop-2-enoyl]-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-6-enoic acid.
| Compound Name | (E)-4-[(E)-3-(3-formyl-4-hydroxyphenyl)prop-2-enoyl]-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 123807494 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (E)-4-[(E)-3-(3-formyl-4-hydroxyphenyl)prop-2-enoyl]-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-6-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)C(CCC(=O)O)C(=O)/C=C/c2ccc(O)c(C=O)c2)ccc1O |
| InChI | InChI=1S/C24H22O8/c1-32-23-13-16(5-10-22(23)29)4-9-21(28)18(6-11-24(30)31)20(27)8-3-15-2-7-19(26)17(12-15)14-25/h2-5,7-10,12-14,18,26,29H,6,11H2,1H3,(H,30,31)/b8-3+,9-4+ |
| InChIKey | AWCRNHDKMILHHH-BQYBEJQRSA-N |
| XLogP | 3.26 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|