C21H19NO6 — CID 59420119
4-amino-2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzaldehyde (PubChem CID 59420119) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 4-amino-2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzaldehyde.
| Compound Name | 4-amino-2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzaldehyde |
|---|---|
| PubChem CID | 59420119 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-amino-2-hydroxy-5-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]benzaldehyde |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2cc(C=O)c(O)cc2N)ccc1O |
| InChI | InChI=1S/C21H19NO6/c1-28-21-8-13(3-7-19(21)26)2-5-16(24)10-17(25)6-4-14-9-15(12-23)20(27)11-18(14)22/h2-9,11-12,26-27H,10,22H2,1H3/b5-2+,6-4+ |
| InChIKey | OZYDTVQBKVPLDA-YBSXJGAUSA-N |
| XLogP | 2.76 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|