C15H16O4 — CID 126550662
4-[(E)-3,6-dioxohept-1-enyl]-2-methoxybenzaldehyde (PubChem CID 126550662) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[(E)-3,6-dioxohept-1-enyl]-2-methoxybenzaldehyde.
| Compound Name | 4-[(E)-3,6-dioxohept-1-enyl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 126550662 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-[(E)-3,6-dioxohept-1-enyl]-2-methoxybenzaldehyde |
| SMILES | COc1cc(/C=C/C(=O)CCC(C)=O)ccc1C=O |
| InChI | InChI=1S/C15H16O4/c1-11(17)3-7-14(18)8-5-12-4-6-13(10-16)15(9-12)19-2/h4-6,8-10H,3,7H2,1-2H3/b8-5+ |
| InChIKey | JKYHPYBLBXVBOI-VMPITWQZSA-N |
| XLogP | 2.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|