C23H24O4 — CID 58901396
1,7-bis(3-methoxy-4-methylphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 58901396) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1,7-bis(3-methoxy-4-methylphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis(3-methoxy-4-methylphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 58901396 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1,7-bis(3-methoxy-4-methylphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(C)c(OC)c2)ccc1C |
| InChI | InChI=1S/C23H24O4/c1-16-5-7-18(13-22(16)26-3)9-11-20(24)15-21(25)12-10-19-8-6-17(2)23(14-19)27-4/h5-14H,15H2,1-4H3 |
| InChIKey | MGVCQFLRCWFHLN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|