C19H24N2O8 — CID 44582717
(4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-5-[(2-methoxy-2-oxoethyl)amino]-5-oxopentanoic acid (PubChem CID 44582717) has the molecular formula C19H24N2O8 and a molecular weight of 408.41 g/mol. Its IUPAC name is (4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-5-[(2-methoxy-2-oxoethyl)amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-5-[(2-methoxy-2-oxoethyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 44582717 |
| Molecular Formula | C19H24N2O8 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-5-[(2-methoxy-2-oxoethyl)amino]-5-oxopentanoic acid |
| SMILES | COC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O8/c1-27-14-7-4-12(10-15(14)28-2)5-8-16(22)21-13(6-9-17(23)24)19(26)20-11-18(25)29-3/h4-5,7-8,10,13H,6,9,11H2,1-3H3,(H,20,26)(H,21,22)(H,23,24)/b8-5+/t13-/m0/s1 |
| InChIKey | LSAVDSMWTYAIPK-LJLILKBBSA-N |
| XLogP | 0.36 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|