C17H21NO7 — CID 56925975
dimethyl (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pentanedioate (PubChem CID 56925975) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 56925975 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | dimethyl (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)/C=C/c1ccc(O)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C17H21NO7/c1-23-14-10-11(4-7-13(14)19)5-8-15(20)18-12(17(22)25-3)6-9-16(21)24-2/h4-5,7-8,10,12,19H,6,9H2,1-3H3,(H,18,20)/b8-5+/t12-/m0/s1 |
| InChIKey | MZMCMLIDLZVBSE-ZCRIDZFUSA-N |
| XLogP | 1.02 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|