C31H47N5O10 — CID 166630653
methyl 6-amino-2-[[(4R)-5-ethoxy-4-[[(2S)-2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoyl]amino]hexanoate (PubChem CID 166630653) has the molecular formula C31H47N5O10 and a molecular weight of 649.74 g/mol. Its IUPAC name is methyl 6-amino-2-[[(4R)-5-ethoxy-4-[[(2S)-2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoyl]amino]hexanoate.
| Compound Name | methyl 6-amino-2-[[(4R)-5-ethoxy-4-[[(2S)-2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 166630653 |
| Molecular Formula | C31H47N5O10 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | methyl 6-amino-2-[[(4R)-5-ethoxy-4-[[(2S)-2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoyl]amino]hexanoate |
| SMILES | CCOC(=O)[C@@H](CCC(=O)NC(CCCCN)C(=O)OC)NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(O)c(OC)c1)C(C)C |
| InChI | InChI=1S/C31H47N5O10/c1-6-46-31(43)22(12-15-26(39)34-21(30(42)45-5)9-7-8-16-32)35-29(41)28(19(2)3)36-27(40)18-33-25(38)14-11-20-10-13-23(37)24(17-20)44-4/h10-11,13-14,17,19,21-22,28,37H,6-9,12,15-16,18,32H2,1-5H3,(H,33,38)(H,34,39)(H,35,41)(H,36,40)/b14-11+/t21?,22-,28+/m1/s1 |
| InChIKey | OYNPOYHWXQPREH-NYDMZULMSA-N |
| XLogP | 0.29 |
| TPSA | 224.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|