C22H31N3O5 — CID 167034418
ethyl 4-[[(2S)-3-methyl-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]butanoyl]amino]butanoate (PubChem CID 167034418) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 4-[[(2S)-3-methyl-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]butanoyl]amino]butanoate.
| Compound Name | ethyl 4-[[(2S)-3-methyl-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 167034418 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethyl 4-[[(2S)-3-methyl-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]butanoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H31N3O5/c1-4-30-20(28)11-8-14-23-22(29)21(16(2)3)25-19(27)15-24-18(26)13-12-17-9-6-5-7-10-17/h5-7,9-10,12-13,16,21H,4,8,11,14-15H2,1-3H3,(H,23,29)(H,24,26)(H,25,27)/b13-12+/t21-/m0/s1 |
| InChIKey | YWNZUOOHMKDUBP-IWGBCORSSA-N |
| XLogP | 1.42 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|