C25H36N4O7 — CID 163263435
diethyl (2S)-2-[[(2S)-2-[[2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]acetyl]-deuterioamino]-3-methylbutanoyl]amino]pentanedioate (PubChem CID 163263435) has the molecular formula C25H36N4O7 and a molecular weight of 505.59 g/mol. Its IUPAC name is diethyl (2S)-2-[[(2S)-2-[[2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]acetyl]-deuterioamino]-3-methylbutanoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[(2S)-2-[[2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]acetyl]-deuterioamino]-3-methylbutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 163263435 |
| Molecular Formula | C25H36N4O7 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | diethyl (2S)-2-[[(2S)-2-[[2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]acetyl]-deuterioamino]-3-methylbutanoyl]amino]pentanedioate |
| SMILES | [2H]N(C(=O)CNC(=O)/C=C/c1ccc(N)cc1)[C@H](C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)C(C)C |
| InChI | InChI=1S/C25H36N4O7/c1-5-35-22(32)14-12-19(25(34)36-6-2)28-24(33)23(16(3)4)29-21(31)15-27-20(30)13-9-17-7-10-18(26)11-8-17/h7-11,13,16,19,23H,5-6,12,14-15,26H2,1-4H3,(H,27,30)(H,28,33)(H,29,31)/b13-9+/t19-,23-/m0/s1/i/hD |
| InChIKey | PJKAERNZLFNOIT-AANBCYCNSA-N |
| XLogP | 0.93 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|