C29H41N3O10 — CID 163263406
(2R)-5-ethoxy-2-[[(2S)-2-[[2-[[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid (PubChem CID 163263406) has the molecular formula C29H41N3O10 and a molecular weight of 591.66 g/mol. Its IUPAC name is (2R)-5-ethoxy-2-[[(2S)-2-[[2-[[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-ethoxy-2-[[(2S)-2-[[2-[[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163263406 |
| Molecular Formula | C29H41N3O10 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (2R)-5-ethoxy-2-[[(2S)-2-[[2-[[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(OC2CCCCO2)c(OC)c1)C(C)C)C(=O)O |
| InChI | InChI=1S/C29H41N3O10/c1-5-40-25(35)14-11-20(29(37)38)31-28(36)27(18(2)3)32-24(34)17-30-23(33)13-10-19-9-12-21(22(16-19)39-4)42-26-8-6-7-15-41-26/h9-10,12-13,16,18,20,26-27H,5-8,11,14-15,17H2,1-4H3,(H,30,33)(H,31,36)(H,32,34)(H,37,38)/b13-10+/t20-,26?,27+/m1/s1 |
| InChIKey | XTMQZIHEDRHDAJ-HXTBAJORSA-N |
| XLogP | 1.78 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|