C36H42O10 — CID 123526731
ethyl (6E)-7-[3-methoxy-4-(oxan-2-yloxy)phenyl]-4-[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]-5-oxohepta-3,6-dienoate (PubChem CID 123526731) has the molecular formula C36H42O10 and a molecular weight of 634.72 g/mol. Its IUPAC name is ethyl (6E)-7-[3-methoxy-4-(oxan-2-yloxy)phenyl]-4-[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]-5-oxohepta-3,6-dienoate.
| Compound Name | ethyl (6E)-7-[3-methoxy-4-(oxan-2-yloxy)phenyl]-4-[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]-5-oxohepta-3,6-dienoate |
|---|---|
| PubChem CID | 123526731 |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | ethyl (6E)-7-[3-methoxy-4-(oxan-2-yloxy)phenyl]-4-[(E)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-enoyl]-5-oxohepta-3,6-dienoate |
| SMILES | CCOC(=O)CC=C(C(=O)/C=C/c1ccc(OC2CCCCO2)c(OC)c1)C(=O)/C=C/c1ccc(OC2CCCCO2)c(OC)c1 |
| InChI | InChI=1S/C36H42O10/c1-4-42-34(39)20-15-27(28(37)16-11-25-13-18-30(32(23-25)40-2)45-35-9-5-7-21-43-35)29(38)17-12-26-14-19-31(33(24-26)41-3)46-36-10-6-8-22-44-36/h11-19,23-24,35-36H,4-10,20-22H2,1-3H3/b16-11+,17-12+,27-15? |
| InChIKey | GZIUFKZQEKKLEQ-JJNNBMBKSA-N |
| XLogP | 6.26 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|