C30H36O6 — CID 11547723
(E)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-3-[3-(3-methylbut-2-enyl)-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 11547723) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-3-[3-(3-methylbut-2-enyl)-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-3-[3-(3-methylbut-2-enyl)-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11547723 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (E)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-3-[3-(3-methylbut-2-enyl)-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | CC(C)=CCc1cc(/C=C/C(=O)c2ccc(OC3CCCCO3)cc2O)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C30H36O6/c1-21(2)9-12-23-19-22(11-16-28(23)36-30-8-4-6-18-34-30)10-15-26(31)25-14-13-24(20-27(25)32)35-29-7-3-5-17-33-29/h9-11,13-16,19-20,29-30,32H,3-8,12,17-18H2,1-2H3/b15-10+ |
| InChIKey | MZMPOZLOAJOZEY-XNTDXEJSSA-N |
| XLogP | 6.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|