C25H28O5 — CID 142670868
1-[2,5-bis(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 142670868) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-[2,5-bis(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2,5-bis(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 142670868 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[2,5-bis(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1cc(OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C25H28O5/c26-22(14-12-19-8-2-1-3-9-19)21-18-20(29-24-10-4-6-16-27-24)13-15-23(21)30-25-11-5-7-17-28-25/h1-3,8-9,12-15,18,24-25H,4-7,10-11,16-17H2 |
| InChIKey | QLZZNCLCHCYGJL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|