C20H20ClNO3 — CID 146312382
(E)-3-(4-chlorophenyl)-N-[3-(oxan-2-yloxy)phenyl]prop-2-enamide (PubChem CID 146312382) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[3-(oxan-2-yloxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[3-(oxan-2-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146312382 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[3-(oxan-2-yloxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Nc1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C20H20ClNO3/c21-16-10-7-15(8-11-16)9-12-19(23)22-17-4-3-5-18(14-17)25-20-6-1-2-13-24-20/h3-5,7-12,14,20H,1-2,6,13H2,(H,22,23)/b12-9+ |
| InChIKey | KCLZCYWXEVHXLW-FMIVXFBMSA-N |
| XLogP | 4.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|