C24H27NO5 — CID 10894846
(E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 10894846) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 10894846 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccnc1)c1cc(OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C24H27NO5/c26-21(11-9-18-6-5-13-25-17-18)20-16-19(29-23-7-1-3-14-27-23)10-12-22(20)30-24-8-2-4-15-28-24/h5-6,9-13,16-17,23-24H,1-4,7-8,14-15H2/b11-9+ |
| InChIKey | OCIJRULYYYSSKH-PKNBQFBNSA-N |
| XLogP | 4.79 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|