C40H52O11 — CID 56925805
(E)-3-[3,4-bis(oxan-2-yloxy)phenyl]-1-[2,4,6-tris(oxan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 56925805) has the molecular formula C40H52O11 and a molecular weight of 708.85 g/mol. Its IUPAC name is (E)-3-[3,4-bis(oxan-2-yloxy)phenyl]-1-[2,4,6-tris(oxan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[3,4-bis(oxan-2-yloxy)phenyl]-1-[2,4,6-tris(oxan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56925805 |
| Molecular Formula | C40H52O11 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | (E)-3-[3,4-bis(oxan-2-yloxy)phenyl]-1-[2,4,6-tris(oxan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC2CCCCO2)c(OC2CCCCO2)c1)c1c(OC2CCCCO2)cc(OC2CCCCO2)cc1OC1CCCCO1 |
| InChI | InChI=1S/C40H52O11/c41-30(18-16-28-17-19-31(48-36-12-2-7-21-43-36)32(25-28)49-37-13-3-8-22-44-37)40-33(50-38-14-4-9-23-45-38)26-29(47-35-11-1-6-20-42-35)27-34(40)51-39-15-5-10-24-46-39/h16-19,25-27,35-39H,1-15,20-24H2/b18-16+ |
| InChIKey | YPXRFVNNXUWALW-FBMGVBCBSA-N |
| XLogP | 8.11 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|