C23H28O6 — CID 46182882
2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane (PubChem CID 46182882) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane.
| Compound Name | 2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane |
|---|---|
| PubChem CID | 46182882 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1OC1CCCCO1 |
| InChI | InChI=1S/C23H28O6/c1-24-18-11-10-16(13-19(18)29-22-7-5-6-12-28-22)8-9-17-14-20(25-2)23(27-4)21(15-17)26-3/h8-11,13-15,22H,5-7,12H2,1-4H3/b9-8+ |
| InChIKey | BFBLWOSNHREFPG-CMDGGOBGSA-N |
| XLogP | 4.80 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|