C22H24O6 — CID 146223495
(E)-1-(2-hydroxy-4-methoxyphenyl)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one (PubChem CID 146223495) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146223495 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[3-methoxy-4-(oxan-2-yloxy)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OC3CCCCO3)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C22H24O6/c1-25-16-8-9-17(19(24)14-16)18(23)10-6-15-7-11-20(21(13-15)26-2)28-22-5-3-4-12-27-22/h6-11,13-14,22,24H,3-5,12H2,1-2H3/b10-6+ |
| InChIKey | XAOHQMIPLUSSNH-UXBLZVDNSA-N |
| XLogP | 4.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|