C31H32O5 — CID 11070942
(E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 11070942) has the molecular formula C31H32O5 and a molecular weight of 484.59 g/mol. Its IUPAC name is (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11070942 |
| Molecular Formula | C31H32O5 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (E)-1-[2,5-bis(oxan-2-yloxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)c1cc(OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C31H32O5/c32-28(18-14-23-12-15-25(16-13-23)24-8-2-1-3-9-24)27-22-26(35-30-10-4-6-20-33-30)17-19-29(27)36-31-11-5-7-21-34-31/h1-3,8-9,12-19,22,30-31H,4-7,10-11,20-21H2/b18-14+ |
| InChIKey | AICGPOLNKZKMOD-NBVRZTHBSA-N |
| XLogP | 7.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|