C24H34O5Si — CID 5386557
tert-butyl-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane (PubChem CID 5386557) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is tert-butyl-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 5386557 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | tert-butyl-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H34O5Si/c1-24(2,3)30(8,9)29-20-14-17(12-13-19(20)25-4)10-11-18-15-21(26-5)23(28-7)22(16-18)27-6/h10-16H,1-9H3/b11-10- |
| InChIKey | UMDKFDJQYNOPRV-KHPPLWFESA-N |
| XLogP | 6.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|