C23H31NO6Si — CID 59904656
tert-butyl-[5-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]-2-methoxyphenoxy]-dimethylsilane (PubChem CID 59904656) has the molecular formula C23H31NO6Si and a molecular weight of 445.59 g/mol. Its IUPAC name is tert-butyl-[5-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]-2-methoxyphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]-2-methoxyphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59904656 |
| Molecular Formula | C23H31NO6Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | tert-butyl-[5-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]-2-methoxyphenoxy]-dimethylsilane |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c([N+](=O)[O-])c2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H31NO6Si/c1-23(2,3)31(7,8)30-20-14-16(11-12-19(20)27-4)9-10-17-13-18(24(25)26)22(29-6)21(15-17)28-5/h9-15H,1-8H3/b10-9- |
| InChIKey | MRUIHSRGEWMURM-KTKRTIGZSA-N |
| XLogP | 6.18 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|