C25H27NO7S — CID 73085599
2-[2-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propan-2-yl]-5-nitrothiophene (PubChem CID 73085599) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-[2-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propan-2-yl]-5-nitrothiophene.
| Compound Name | 2-[2-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propan-2-yl]-5-nitrothiophene |
|---|---|
| PubChem CID | 73085599 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[2-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propan-2-yl]-5-nitrothiophene |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1OC(C)(C)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C25H27NO7S/c1-25(2,22-11-12-23(34-22)26(27)28)33-19-13-16(9-10-18(19)29-3)7-8-17-14-20(30-4)24(32-6)21(15-17)31-5/h7-15H,1-6H3 |
| InChIKey | WZSKVKFBTMLUAY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|