C29H32N2O9S — CID 11353744
[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] [1-methyl-4-(5-nitrothiophen-2-yl)piperidin-4-yl] carbonate (PubChem CID 11353744) has the molecular formula C29H32N2O9S and a molecular weight of 584.65 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] [1-methyl-4-(5-nitrothiophen-2-yl)piperidin-4-yl] carbonate.
| Compound Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] [1-methyl-4-(5-nitrothiophen-2-yl)piperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 11353744 |
| Molecular Formula | C29H32N2O9S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] [1-methyl-4-(5-nitrothiophen-2-yl)piperidin-4-yl] carbonate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC(=O)OC1(c2ccc([N+](=O)[O-])s2)CCN(C)CC1 |
| InChI | InChI=1S/C29H32N2O9S/c1-30-14-12-29(13-15-30,25-10-11-26(41-25)31(33)34)40-28(32)39-22-16-19(8-9-21(22)35-2)6-7-20-17-23(36-3)27(38-5)24(18-20)37-4/h6-11,16-18H,12-15H2,1-5H3/b7-6- |
| InChIKey | PRSAKYCJDYGAAU-SREVYHEPSA-N |
| XLogP | 6.00 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|