C23H26O9 — CID 20742908
methyl 2-[2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-2-oxoethoxy]acetate (PubChem CID 20742908) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is methyl 2-[2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-2-oxoethoxy]acetate.
| Compound Name | methyl 2-[2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 20742908 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 2-[2-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-2-oxoethoxy]acetate |
| SMILES | COC(=O)COCC(=O)Oc1cc(/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C23H26O9/c1-26-17-9-8-15(10-18(17)32-22(25)14-31-13-21(24)29-4)6-7-16-11-19(27-2)23(30-5)20(12-16)28-3/h6-12H,13-14H2,1-5H3/b7-6+ |
| InChIKey | MJOYKVNZIRCCSI-VOTSOKGWSA-N |
| XLogP | 2.99 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|