C25H25NO8 — CID 77450683
[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 77450683) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 77450683 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1OC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H25NO8/c1-30-18-8-7-16(5-6-17-14-20(31-2)25(33-4)21(15-17)32-3)13-19(18)34-24(29)11-12-26-22(27)9-10-23(26)28/h5-10,13-15H,11-12H2,1-4H3 |
| InChIKey | WELXSSAIVSHVCI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|