C35H45N3O9S2 — CID 58583020
[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N-butyl-N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]carbamate (PubChem CID 58583020) has the molecular formula C35H45N3O9S2 and a molecular weight of 715.89 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N-butyl-N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]carbamate.
| Compound Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N-butyl-N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 58583020 |
| Molecular Formula | C35H45N3O9S2 |
| Molecular Weight | 715.89 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N-butyl-N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]carbamate |
| SMILES | CCCCN(CCSSC(C)(C)CC(=O)NCN1C(=O)C=CC1=O)C(=O)Oc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C35H45N3O9S2/c1-8-9-16-37(17-18-48-49-35(2,3)22-30(39)36-23-38-31(40)14-15-32(38)41)34(42)47-27-19-24(12-13-26(27)43-4)10-11-25-20-28(44-5)33(46-7)29(21-25)45-6/h10-15,19-21H,8-9,16-18,22-23H2,1-7H3,(H,36,39)/b11-10- |
| InChIKey | HZJSQRSRNJNHEU-KHPPLWFESA-N |
| XLogP | 6.04 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|