C32H39N3O5S2 — CID 58680146
[2-methyl-5-[(Z)-2-(3,4,5-trimethylphenyl)ethenyl]phenyl] N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]-N-methylcarbamate (PubChem CID 58680146) has the molecular formula C32H39N3O5S2 and a molecular weight of 609.81 g/mol. Its IUPAC name is [2-methyl-5-[(Z)-2-(3,4,5-trimethylphenyl)ethenyl]phenyl] N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]-N-methylcarbamate.
| Compound Name | [2-methyl-5-[(Z)-2-(3,4,5-trimethylphenyl)ethenyl]phenyl] N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58680146 |
| Molecular Formula | C32H39N3O5S2 |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | [2-methyl-5-[(Z)-2-(3,4,5-trimethylphenyl)ethenyl]phenyl] N-[2-[[4-[(2,5-dioxopyrrol-1-yl)methylamino]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethyl]-N-methylcarbamate |
| SMILES | Cc1ccc(/C=C\c2cc(C)c(C)c(C)c2)cc1OC(=O)N(C)CCSSC(C)(C)CC(=O)NCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C32H39N3O5S2/c1-21-8-9-25(10-11-26-16-22(2)24(4)23(3)17-26)18-27(21)40-31(39)34(7)14-15-41-42-32(5,6)19-28(36)33-20-35-29(37)12-13-30(35)38/h8-13,16-18H,14-15,19-20H2,1-7H3,(H,33,36)/b11-10- |
| InChIKey | CVIBPBPSQVEXKG-KHPPLWFESA-N |
| XLogP | 6.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|