C22H26ClNO8 — CID 5467055
2-amino-4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid;hydrochloride (PubChem CID 5467055) has the molecular formula C22H26ClNO8 and a molecular weight of 467.90 g/mol. Its IUPAC name is 2-amino-4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid;hydrochloride.
| Compound Name | 2-amino-4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 5467055 |
| Molecular Formula | C22H26ClNO8 |
| Molecular Weight | 467.90 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-amino-4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid;hydrochloride |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC(=O)CC(N)C(=O)O.Cl |
| InChI | InChI=1S/C22H25NO8.ClH/c1-27-16-8-7-13(9-17(16)31-20(24)12-15(23)22(25)26)5-6-14-10-18(28-2)21(30-4)19(11-14)29-3;/h5-11,15H,12,23H2,1-4H3,(H,25,26);1H/b6-5-; |
| InChIKey | VJKRVUFIERGGGG-YSMBQZINSA-N |
| XLogP | 3.02 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|