C24H29N3O7 — CID 174464881
2,4-diamino-4-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]iminobutanoic acid (PubChem CID 174464881) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2,4-diamino-4-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]iminobutanoic acid.
| Compound Name | 2,4-diamino-4-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]iminobutanoic acid |
|---|---|
| PubChem CID | 174464881 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2,4-diamino-4-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]iminobutanoic acid |
| SMILES | COc1ccc(C=C(C)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1/N=C(/N)CC(N)C(=O)O |
| InChI | InChI=1S/C24H29N3O7/c1-13(22(28)15-10-19(32-3)23(34-5)20(11-15)33-4)8-14-6-7-18(31-2)17(9-14)27-21(26)12-16(25)24(29)30/h6-11,16H,12,25H2,1-5H3,(H2,26,27)(H,29,30) |
| InChIKey | XAGGCHBOAVHFMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|