C23H31N2O11P — CID 11432698
2,5-diamino-5-oxopentanoic acid;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 11432698) has the molecular formula C23H31N2O11P and a molecular weight of 542.48 g/mol. Its IUPAC name is 2,5-diamino-5-oxopentanoic acid;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | 2,5-diamino-5-oxopentanoic acid;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11432698 |
| Molecular Formula | C23H31N2O11P |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 2,5-diamino-5-oxopentanoic acid;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O.NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C18H21O8P.C5H10N2O3/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;6-3(5(9)10)1-2-4(7)8/h5-11H,1-4H3,(H2,19,20,21);3H,1-2,6H2,(H2,7,8)(H,9,10)/b6-5-; |
| InChIKey | NBJNSYDTPBCXJH-YSMBQZINSA-N |
| XLogP | 2.03 |
| TPSA | 210.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|