C19H22I2NO8P — CID 57382618
[5-[(Z)-2-(3,5-diiodo-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate;methyl 2-aminoacetate (PubChem CID 57382618) has the molecular formula C19H22I2NO8P and a molecular weight of 677.17 g/mol. Its IUPAC name is [5-[(Z)-2-(3,5-diiodo-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate;methyl 2-aminoacetate.
| Compound Name | [5-[(Z)-2-(3,5-diiodo-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate;methyl 2-aminoacetate |
|---|---|
| PubChem CID | 57382618 |
| Molecular Formula | C19H22I2NO8P |
| Molecular Weight | 677.17 g/mol |
| Exact Mass | 676.92 |
| IUPAC Name | [5-[(Z)-2-(3,5-diiodo-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate;methyl 2-aminoacetate |
| SMILES | COC(=O)CN.COc1ccc(/C=C\c2cc(I)c(OC)c(I)c2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C16H15I2O6P.C3H7NO2/c1-22-14-6-5-10(9-15(14)24-25(19,20)21)3-4-11-7-12(17)16(23-2)13(18)8-11;1-6-3(5)2-4/h3-9H,1-2H3,(H2,19,20,21);2,4H2,1H3/b4-3-; |
| InChIKey | OYGIRFQODMPNIA-LNKPDPKZSA-N |
| XLogP | 3.67 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|