C26H35ClN6O8 — CID 174464882
2-amino-5-[carbamimidoyl(nitro)amino]-N-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]pentanamide;hydrochloride (PubChem CID 174464882) has the molecular formula C26H35ClN6O8 and a molecular weight of 595.05 g/mol. Its IUPAC name is 2-amino-5-[carbamimidoyl(nitro)amino]-N-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-5-[carbamimidoyl(nitro)amino]-N-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 174464882 |
| Molecular Formula | C26H35ClN6O8 |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 2-amino-5-[carbamimidoyl(nitro)amino]-N-[2-methoxy-5-[2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]pentanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(CCCC(N)C(=O)Nc1cc(C=C(C)C(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OC)[N+](=O)[O-] |
| InChI | InChI=1S/C26H34N6O8.ClH/c1-15(23(33)17-13-21(38-3)24(40-5)22(14-17)39-4)11-16-8-9-20(37-2)19(12-16)30-25(34)18(27)7-6-10-31(26(28)29)32(35)36;/h8-9,11-14,18H,6-7,10,27H2,1-5H3,(H3,28,29)(H,30,34);1H |
| InChIKey | JPBQOTJKVYHHRZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 205.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|