C24H31N5O7 — CID 91260000
5-[carbamimidoyl(nitro)amino]-2-[2-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]pentanoic acid (PubChem CID 91260000) has the molecular formula C24H31N5O7 and a molecular weight of 501.54 g/mol. Its IUPAC name is 5-[carbamimidoyl(nitro)amino]-2-[2-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]pentanoic acid.
| Compound Name | 5-[carbamimidoyl(nitro)amino]-2-[2-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]pentanoic acid |
|---|---|
| PubChem CID | 91260000 |
| Molecular Formula | C24H31N5O7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[carbamimidoyl(nitro)amino]-2-[2-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]pentanoic acid |
| SMILES | [H]/N=C(\N)N(CCCC(Nc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)ccc1C)C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C24H31N5O7/c1-15-7-8-16(9-10-17-13-20(34-2)22(36-4)21(14-17)35-3)12-19(15)27-18(23(30)31)6-5-11-28(24(25)26)29(32)33/h7-10,12-14,18,27H,5-6,11H2,1-4H3,(H3,25,26)(H,30,31) |
| InChIKey | RRYJVZIJEMFGRN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|