C32H28O6 — CID 58864023
[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 9H-fluorene-9-carboxylate (PubChem CID 58864023) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 9H-fluorene-9-carboxylate.
| Compound Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 9H-fluorene-9-carboxylate |
|---|---|
| PubChem CID | 58864023 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 9H-fluorene-9-carboxylate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC(=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H28O6/c1-34-26-16-15-20(13-14-21-18-28(35-2)31(37-4)29(19-21)36-3)17-27(26)38-32(33)30-24-11-7-5-9-22(24)23-10-6-8-12-25(23)30/h5-19,30H,1-4H3/b14-13- |
| InChIKey | BNOODOZEYLYPNO-YPKPFQOOSA-N |
| XLogP | 6.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|