C35H41NO7 — CID 118715953
5-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]pentyl 9H-fluorene-9-carboxylate (PubChem CID 118715953) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is 5-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]pentyl 9H-fluorene-9-carboxylate.
| Compound Name | 5-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]pentyl 9H-fluorene-9-carboxylate |
|---|---|
| PubChem CID | 118715953 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 5-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]pentyl 9H-fluorene-9-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)OCCCN(C)CCCCCOC(=O)C2c3ccccc3-c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C35H41NO7/c1-36(20-12-22-42-32(37)18-17-25-23-30(39-2)34(41-4)31(24-25)40-3)19-10-5-11-21-43-35(38)33-28-15-8-6-13-26(28)27-14-7-9-16-29(27)33/h6-9,13-18,23-24,33H,5,10-12,19-22H2,1-4H3/b18-17+ |
| InChIKey | IZWAKYIFDOKGIG-ISLYRVAYSA-N |
| XLogP | 6.12 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|