C39H47NO7 — CID 155528166
7-[methyl-[(2S)-2-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]heptyl anthracene-9-carboxylate (PubChem CID 155528166) has the molecular formula C39H47NO7 and a molecular weight of 641.81 g/mol. Its IUPAC name is 7-[methyl-[(2S)-2-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]heptyl anthracene-9-carboxylate.
| Compound Name | 7-[methyl-[(2S)-2-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]heptyl anthracene-9-carboxylate |
|---|---|
| PubChem CID | 155528166 |
| Molecular Formula | C39H47NO7 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | 7-[methyl-[(2S)-2-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]heptyl anthracene-9-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)OC[C@@H](C)CN(C)CCCCCCCOC(=O)c2c3ccccc3cc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C39H47NO7/c1-28(27-47-36(41)20-19-29-23-34(43-3)38(45-5)35(24-29)44-4)26-40(2)21-13-7-6-8-14-22-46-39(42)37-32-17-11-9-15-30(32)25-31-16-10-12-18-33(31)37/h9-12,15-20,23-25,28H,6-8,13-14,21-22,26-27H2,1-5H3/b20-19+/t28-/m0/s1 |
| InChIKey | KANUQSLCHFWUCR-PDRZGFNUSA-N |
| XLogP | 7.95 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|