C34H48N2O10 — CID 11714369
3-[methyl-[2-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]ethyl]amino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 11714369) has the molecular formula C34H48N2O10 and a molecular weight of 644.76 g/mol. Its IUPAC name is 3-[methyl-[2-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]ethyl]amino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 3-[methyl-[2-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]ethyl]amino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11714369 |
| Molecular Formula | C34H48N2O10 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | 3-[methyl-[2-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]ethyl]amino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCN(C)CCN(C)CCCOC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H48N2O10/c1-35(15-9-19-45-31(37)13-11-25-21-27(39-3)33(43-7)28(22-25)40-4)17-18-36(2)16-10-20-46-32(38)14-12-26-23-29(41-5)34(44-8)30(24-26)42-6/h11-14,21-24H,9-10,15-20H2,1-8H3/b13-11+,14-12+ |
| InChIKey | IMGNTNRBPDJWPK-PHEQNACWSA-N |
| XLogP | 4.20 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|