C30H36N2O8 — CID 118715931
3-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]propyl 6-methoxyquinoline-4-carboxylate (PubChem CID 118715931) has the molecular formula C30H36N2O8 and a molecular weight of 552.62 g/mol. Its IUPAC name is 3-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]propyl 6-methoxyquinoline-4-carboxylate.
| Compound Name | 3-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]propyl 6-methoxyquinoline-4-carboxylate |
|---|---|
| PubChem CID | 118715931 |
| Molecular Formula | C30H36N2O8 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 3-[methyl-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]amino]propyl 6-methoxyquinoline-4-carboxylate |
| SMILES | COc1ccc2nccc(C(=O)OCCCN(C)CCCOC(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C30H36N2O8/c1-32(15-7-17-40-30(34)23-12-13-31-25-10-9-22(35-2)20-24(23)25)14-6-16-39-28(33)11-8-21-18-26(36-3)29(38-5)27(19-21)37-4/h8-13,18-20H,6-7,14-17H2,1-5H3/b11-8+ |
| InChIKey | IVNAHESVEAETME-DHZHZOJOSA-N |
| XLogP | 4.39 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|