C37H43NO7 — CID 155556498
4-[methyl-[5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypentyl]amino]butyl anthracene-9-carboxylate (PubChem CID 155556498) has the molecular formula C37H43NO7 and a molecular weight of 613.75 g/mol. Its IUPAC name is 4-[methyl-[5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypentyl]amino]butyl anthracene-9-carboxylate.
| Compound Name | 4-[methyl-[5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypentyl]amino]butyl anthracene-9-carboxylate |
|---|---|
| PubChem CID | 155556498 |
| Molecular Formula | C37H43NO7 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | 4-[methyl-[5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypentyl]amino]butyl anthracene-9-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCCN(C)CCCCOC(=O)c2c3ccccc3cc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C37H43NO7/c1-38(20-10-5-12-22-44-34(39)19-18-27-24-32(41-2)36(43-4)33(25-27)42-3)21-11-13-23-45-37(40)35-30-16-8-6-14-28(30)26-29-15-7-9-17-31(29)35/h6-9,14-19,24-26H,5,10-13,20-23H2,1-4H3/b19-18+ |
| InChIKey | DQMWLRAUCMTUIM-VHEBQXMUSA-N |
| XLogP | 7.31 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|