About 2-(dimethylamino)ethyl anthracene-9-carboxylate
2-(dimethylamino)ethyl anthracene-9-carboxylate (PubChem CID 71404240) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl anthracene-9-carboxylate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl anthracene-9-carboxylate |
| PubChem CID | 71404240 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(dimethylamino)ethyl anthracene-9-carboxylate |
| SMILES | CN(C)CCOC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H19NO2/c1-20(2)11-12-22-19(21)18-16-9-5-3-7-14(16)13-15-8-4-6-10-17(15)18/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | GVCONYDDUMOQGA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl anthracene-9-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl anthracene-9-carboxylate (CID 71404240) is 2-(dimethylamino)ethyl anthracene-9-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl anthracene-9-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl anthracene-9-carboxylate is CN(C)CCOC(=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of 2-(dimethylamino)ethyl anthracene-9-carboxylate?
The InChIKey is GVCONYDDUMOQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-20(2)11-12-22-19(21)18-16-9-5-3-7-14(16)13-15-8-4-6-10-17(15)18/h3-10,13H,11-12H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl anthracene-9-carboxylate?
2-(dimethylamino)ethyl anthracene-9-carboxylate has a molecular weight of 293.37 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl anthracene-9-carboxylate is sourced from PubChem (CID 71404240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).