About 4-bromobutyl anthracene-9-carboxylate
4-bromobutyl anthracene-9-carboxylate (PubChem CID 71345742) has the molecular formula C19H17BrO2
and a molecular weight of 357.25 g/mol. Its IUPAC name is 4-bromobutyl anthracene-9-carboxylate.
Molecular Properties
| Compound Name | 4-bromobutyl anthracene-9-carboxylate |
| PubChem CID | 71345742 |
| Molecular Formula | C19H17BrO2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 4-bromobutyl anthracene-9-carboxylate |
| SMILES | O=C(OCCCCBr)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H17BrO2/c20-11-5-6-12-22-19(21)18-16-9-3-1-7-14(16)13-15-8-2-4-10-17(15)18/h1-4,7-10,13H,5-6,11-12H2 |
| InChIKey | PDBKCUFIUPRGOO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobutyl anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobutyl anthracene-9-carboxylate?
The IUPAC name of 4-bromobutyl anthracene-9-carboxylate (CID 71345742) is 4-bromobutyl anthracene-9-carboxylate.
What is the SMILES notation for 4-bromobutyl anthracene-9-carboxylate?
The canonical SMILES for 4-bromobutyl anthracene-9-carboxylate is O=C(OCCCCBr)c1c2ccccc2cc2ccccc12.
What is the InChIKey of 4-bromobutyl anthracene-9-carboxylate?
The InChIKey is PDBKCUFIUPRGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrO2/c20-11-5-6-12-22-19(21)18-16-9-3-1-7-14(16)13-15-8-2-4-10-17(15)18/h1-4,7-10,13H,5-6,11-12H2.
What are the key properties of 4-bromobutyl anthracene-9-carboxylate?
4-bromobutyl anthracene-9-carboxylate has a molecular weight of 357.25 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobutyl anthracene-9-carboxylate is sourced from PubChem (CID 71345742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).