About [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate
[3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate (PubChem CID 59482739) has the molecular formula C26H30O4
and a molecular weight of 406.52 g/mol. Its IUPAC name is [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate.
Molecular Properties
| Compound Name | [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate |
| PubChem CID | 59482739 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)CCOC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H30O4/c1-6-25(2,3)24(28)30-26(4,5)15-16-29-23(27)22-20-13-9-7-11-18(20)17-19-12-8-10-14-21(19)22/h7-14,17H,6,15-16H2,1-5H3 |
| InChIKey | RMUMKJWRQXOPJR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate?
The IUPAC name of [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate (CID 59482739) is [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate.
What is the SMILES notation for [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate?
The canonical SMILES for [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate is CCC(C)(C)C(=O)OC(C)(C)CCOC(=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate?
The InChIKey is RMUMKJWRQXOPJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O4/c1-6-25(2,3)24(28)30-26(4,5)15-16-29-23(27)22-20-13-9-7-11-18(20)17-19-12-8-10-14-21(19)22/h7-14,17H,6,15-16H2,1-5H3.
What are the key properties of [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate?
[3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate has a molecular weight of 406.52 g/mol, XLogP of 6.30, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate is sourced from PubChem (CID 59482739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).