C26H30O4 — CID 59482739
[3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate (PubChem CID 59482739) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate.
| Compound Name | [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 59482739 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [3-(2,2-dimethylbutanoyloxy)-3-methylbutyl] anthracene-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)CCOC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H30O4/c1-6-25(2,3)24(28)30-26(4,5)15-16-29-23(27)22-20-13-9-7-11-18(20)17-19-12-8-10-14-21(19)22/h7-14,17H,6,15-16H2,1-5H3 |
| InChIKey | RMUMKJWRQXOPJR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|