About 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate
2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate (PubChem CID 163713436) has the molecular formula C23H22O5
and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate.
Molecular Properties
| Compound Name | 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate |
| PubChem CID | 163713436 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate |
| SMILES | C=CC(=O)OCCCOCCOC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H22O5/c1-2-21(24)27-13-7-12-26-14-15-28-23(25)22-19-10-5-3-8-17(19)16-18-9-4-6-11-20(18)22/h2-6,8-11,16H,1,7,12-15H2 |
| InChIKey | KLGPRGTZKZWDFL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate?
The IUPAC name of 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate (CID 163713436) is 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate.
What is the SMILES notation for 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate?
The canonical SMILES for 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate is C=CC(=O)OCCCOCCOC(=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate?
The InChIKey is KLGPRGTZKZWDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O5/c1-2-21(24)27-13-7-12-26-14-15-28-23(25)22-19-10-5-3-8-17(19)16-18-9-4-6-11-20(18)22/h2-6,8-11,16H,1,7,12-15H2.
What are the key properties of 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate?
2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate has a molecular weight of 378.42 g/mol, XLogP of 4.29, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-prop-2-enoyloxypropoxy)ethyl anthracene-9-carboxylate is sourced from PubChem (CID 163713436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).