C16H14O6 — CID 22348600
2-hydroxy-3-(2-prop-2-enoyloxyethoxy)naphthalene-1-carboxylic acid (PubChem CID 22348600) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-hydroxy-3-(2-prop-2-enoyloxyethoxy)naphthalene-1-carboxylic acid.
| Compound Name | 2-hydroxy-3-(2-prop-2-enoyloxyethoxy)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 22348600 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-hydroxy-3-(2-prop-2-enoyloxyethoxy)naphthalene-1-carboxylic acid |
| SMILES | C=CC(=O)OCCOc1cc2ccccc2c(C(=O)O)c1O |
| InChI | InChI=1S/C16H14O6/c1-2-13(17)22-8-7-21-12-9-10-5-3-4-6-11(10)14(15(12)18)16(19)20/h2-6,9,18H,1,7-8H2,(H,19,20) |
| InChIKey | XFOWMWUONTXXJX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|