C20H17N3O3S2 — CID 121373988
2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]oxy]ethyl prop-2-enoate (PubChem CID 121373988) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]oxy]ethyl prop-2-enoate.
| Compound Name | 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 121373988 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1nc(Sc2ccccc2)nc(Sc2ccccc2)n1 |
| InChI | InChI=1S/C20H17N3O3S2/c1-2-17(24)25-13-14-26-18-21-19(27-15-9-5-3-6-10-15)23-20(22-18)28-16-11-7-4-8-12-16/h2-12H,1,13-14H2 |
| InChIKey | DUZMIAARYLECMJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|