C42H32N10O4S2 — CID 155065687
[4-[[4-phenylsulfanyl-6-[4-[[4-phenylsulfanyl-6-(4-prop-2-enoyloxyanilino)-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate (PubChem CID 155065687) has the molecular formula C42H32N10O4S2 and a molecular weight of 804.92 g/mol. Its IUPAC name is [4-[[4-phenylsulfanyl-6-[4-[[4-phenylsulfanyl-6-(4-prop-2-enoyloxyanilino)-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate.
| Compound Name | [4-[[4-phenylsulfanyl-6-[4-[[4-phenylsulfanyl-6-(4-prop-2-enoyloxyanilino)-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 155065687 |
| Molecular Formula | C42H32N10O4S2 |
| Molecular Weight | 804.92 g/mol |
| Exact Mass | 804.20 |
| IUPAC Name | [4-[[4-phenylsulfanyl-6-[4-[[4-phenylsulfanyl-6-(4-prop-2-enoyloxyanilino)-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(Nc2nc(Nc3ccc(Nc4nc(Nc5ccc(OC(=O)C=C)cc5)nc(Sc5ccccc5)n4)cc3)nc(Sc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C42H32N10O4S2/c1-3-35(53)55-31-23-19-29(20-24-31)45-39-47-37(49-41(51-39)57-33-11-7-5-8-12-33)43-27-15-17-28(18-16-27)44-38-48-40(52-42(50-38)58-34-13-9-6-10-14-34)46-30-21-25-32(26-22-30)56-36(54)4-2/h3-26H,1-2H2,(H2,43,45,47,49,51)(H2,44,46,48,50,52) |
| InChIKey | DBGRHOJGGUZVIW-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 178.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.92 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|