About phenyl prop-2-enoate;triphenylene
phenyl prop-2-enoate;triphenylene (PubChem CID 159225619) has the molecular formula C27H20O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is phenyl prop-2-enoate;triphenylene.
Molecular Properties
| Compound Name | phenyl prop-2-enoate;triphenylene |
| PubChem CID | 159225619 |
| Molecular Formula | C27H20O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | phenyl prop-2-enoate;triphenylene |
| SMILES | C=CC(=O)Oc1ccccc1.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12.C9H8O2/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-2-9(10)11-8-6-4-3-5-7-8/h1-12H;2-7H,1H2 |
| InChIKey | KSGAIJYUFDXHEJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenyl prop-2-enoate;triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl prop-2-enoate;triphenylene?
The IUPAC name of phenyl prop-2-enoate;triphenylene (CID 159225619) is phenyl prop-2-enoate;triphenylene.
What is the SMILES notation for phenyl prop-2-enoate;triphenylene?
The canonical SMILES for phenyl prop-2-enoate;triphenylene is C=CC(=O)Oc1ccccc1.c1ccc2c(c1)c1ccccc1c1ccccc21.
What is the InChIKey of phenyl prop-2-enoate;triphenylene?
The InChIKey is KSGAIJYUFDXHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C9H8O2/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-2-9(10)11-8-6-4-3-5-7-8/h1-12H;2-7H,1H2.
What are the key properties of phenyl prop-2-enoate;triphenylene?
phenyl prop-2-enoate;triphenylene has a molecular weight of 376.46 g/mol, XLogP of 6.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl prop-2-enoate;triphenylene is sourced from PubChem (CID 159225619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).